C24H20FNO6 — CID 132577626
(2E)-6-acetyl-2-[1-(3-fluoroanilino)ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 132577626) has the molecular formula C24H20FNO6 and a molecular weight of 437.42 g/mol. Its IUPAC name is (2E)-6-acetyl-2-[1-(3-fluoroanilino)ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (2E)-6-acetyl-2-[1-(3-fluoroanilino)ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 132577626 |
| Molecular Formula | C24H20FNO6 |
| Molecular Weight | 437.42 g/mol |
| Exact Mass | 437.13 |
| IUPAC Name | (2E)-6-acetyl-2-[1-(3-fluoroanilino)ethylidene]-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)Nc3cccc(F)c3)C(=O)C12C |
| InChI | InChI=1S/C24H20FNO6/c1-10-20(29)18(12(3)27)22-19(21(10)30)24(4)16(32-22)9-15(28)17(23(24)31)11(2)26-14-7-5-6-13(25)8-14/h5-9,26,29-30H,1-4H3/b17-11+ |
| InChIKey | PNNILZAOSOEYRV-GZTJUZNOSA-N |
| XLogP | 3.82 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.42 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|