C24H21NO6 — CID 132577627
(2E,9bS)-6-acetyl-2-(1-anilinoethylidene)-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione (PubChem CID 132577627) has the molecular formula C24H21NO6 and a molecular weight of 419.43 g/mol. Its IUPAC name is (2E,9bS)-6-acetyl-2-(1-anilinoethylidene)-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione.
| Compound Name | (2E,9bS)-6-acetyl-2-(1-anilinoethylidene)-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
|---|---|
| PubChem CID | 132577627 |
| Molecular Formula | C24H21NO6 |
| Molecular Weight | 419.43 g/mol |
| Exact Mass | 419.14 |
| IUPAC Name | (2E,9bS)-6-acetyl-2-(1-anilinoethylidene)-7,9-dihydroxy-8,9b-dimethyldibenzofuran-1,3-dione |
| SMILES | CC(=O)c1c(O)c(C)c(O)c2c1OC1=CC(=O)/C(=C(/C)Nc3ccccc3)C(=O)[C@]12C |
| InChI | InChI=1S/C24H21NO6/c1-11-20(28)18(13(3)26)22-19(21(11)29)24(4)16(31-22)10-15(27)17(23(24)30)12(2)25-14-8-6-5-7-9-14/h5-10,25,28-29H,1-4H3/b17-12+/t24-/m1/s1 |
| InChIKey | XPFSFYYQNTXFRI-SKELBMGJSA-N |
| XLogP | 3.68 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.43 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|