About methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate
methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate (PubChem CID 132578140) has the molecular formula C21H18F3NO2
and a molecular weight of 373.37 g/mol. Its IUPAC name is methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate.
Molecular Properties
| Compound Name | methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate |
| PubChem CID | 132578140 |
| Molecular Formula | C21H18F3NO2 |
| Molecular Weight | 373.37 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate |
| SMILES | COC(=O)c1c(-c2ccccc2)cn(-c2cc(C)ccc2C)c1C(F)(F)F |
| InChI | InChI=1S/C21H18F3NO2/c1-13-9-10-14(2)17(11-13)25-12-16(15-7-5-4-6-8-15)18(20(26)27-3)19(25)21(22,23)24/h4-12H,1-3H3 |
| InChIKey | XGGXTNZBACTOLJ-UHFFFAOYSA-N |
| XLogP | 5.57 |
| TPSA | 31.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 373.37 |
| LogP ≤ 5 | 5.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate?
The IUPAC name of methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate (CID 132578140) is methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate.
What is the SMILES notation for methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate?
The canonical SMILES for methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate is COC(=O)c1c(-c2ccccc2)cn(-c2cc(C)ccc2C)c1C(F)(F)F.
What is the InChIKey of methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate?
The InChIKey is XGGXTNZBACTOLJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H18F3NO2/c1-13-9-10-14(2)17(11-13)25-12-16(15-7-5-4-6-8-15)18(20(26)27-3)19(25)21(22,23)24/h4-12H,1-3H3.
What are the key properties of methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate?
methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate has a molecular weight of 373.37 g/mol, XLogP of 5.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 1-(2,5-dimethylphenyl)-4-phenyl-2-(trifluoromethyl)pyrrole-3-carboxylate is sourced from PubChem (CID 132578140), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).