C15H25N — CID 13257835
3,11b-dimethyl-1,2,3,4,6,7,8,9,10,11-decahydrobenzo[a]quinolizine (PubChem CID 13257835) has the molecular formula C15H25N and a molecular weight of 219.37 g/mol. Its IUPAC name is 3,11b-dimethyl-1,2,3,4,6,7,8,9,10,11-decahydrobenzo[a]quinolizine.
| Compound Name | 3,11b-dimethyl-1,2,3,4,6,7,8,9,10,11-decahydrobenzo[a]quinolizine |
|---|---|
| PubChem CID | 13257835 |
| Molecular Formula | C15H25N |
| Molecular Weight | 219.37 g/mol |
| Exact Mass | 219.20 |
| IUPAC Name | 3,11b-dimethyl-1,2,3,4,6,7,8,9,10,11-decahydrobenzo[a]quinolizine |
| SMILES | CC1CCC2(C)C3=C(CCCC3)CCN2C1 |
| InChI | InChI=1S/C15H25N/c1-12-7-9-15(2)14-6-4-3-5-13(14)8-10-16(15)11-12/h12H,3-11H2,1-2H3 |
| InChIKey | VVFRNCRIUGQNSU-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|