About 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene
2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene (PubChem CID 132578741) has the molecular formula C15H16O2
and a molecular weight of 228.29 g/mol. Its IUPAC name is 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene.
Molecular Properties
| Compound Name | 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene |
| PubChem CID | 132578741 |
| Molecular Formula | C15H16O2 |
| Molecular Weight | 228.29 g/mol |
| Exact Mass | 228.12 |
| IUPAC Name | 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene |
| SMILES | CC=C=CC1=Cc2c(OC)ccc(OC)c2C1 |
| InChI | InChI=1S/C15H16O2/c1-4-5-6-11-9-12-13(10-11)15(17-3)8-7-14(12)16-2/h4,6-9H,10H2,1-3H3 |
| InChIKey | MCTDPKXQFMHZOZ-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 228.29 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene?
The IUPAC name of 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene (CID 132578741) is 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene.
What is the SMILES notation for 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene?
The canonical SMILES for 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene is CC=C=CC1=Cc2c(OC)ccc(OC)c2C1.
What is the InChIKey of 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene?
The InChIKey is MCTDPKXQFMHZOZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16O2/c1-4-5-6-11-9-12-13(10-11)15(17-3)8-7-14(12)16-2/h4,6-9H,10H2,1-3H3.
What are the key properties of 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene?
2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene has a molecular weight of 228.29 g/mol, XLogP of 3.37, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-buta-1,2-dienyl-4,7-dimethoxy-1H-indene is sourced from PubChem (CID 132578741), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).