C21H30O7 — CID 132578871
[(7R,8R,8aR)-3-[(E,3R,4R,5S)-3,4-dihydroxy-3,5-dimethylhept-1-enyl]-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-8-yl] acetate (PubChem CID 132578871) has the molecular formula C21H30O7 and a molecular weight of 394.46 g/mol. Its IUPAC name is [(7R,8R,8aR)-3-[(E,3R,4R,5S)-3,4-dihydroxy-3,5-dimethylhept-1-enyl]-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-8-yl] acetate.
| Compound Name | [(7R,8R,8aR)-3-[(E,3R,4R,5S)-3,4-dihydroxy-3,5-dimethylhept-1-enyl]-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-8-yl] acetate |
|---|---|
| PubChem CID | 132578871 |
| Molecular Formula | C21H30O7 |
| Molecular Weight | 394.46 g/mol |
| Exact Mass | 394.20 |
| IUPAC Name | [(7R,8R,8aR)-3-[(E,3R,4R,5S)-3,4-dihydroxy-3,5-dimethylhept-1-enyl]-7-hydroxy-7-methyl-6-oxo-8,8a-dihydro-1H-isochromen-8-yl] acetate |
| SMILES | CC[C@H](C)[C@@H](O)[C@](C)(O)/C=C/C1=CC2=CC(=O)[C@](C)(O)[C@H](OC(C)=O)[C@H]2CO1 |
| InChI | InChI=1S/C21H30O7/c1-6-12(2)18(24)20(4,25)8-7-15-9-14-10-17(23)21(5,26)19(28-13(3)22)16(14)11-27-15/h7-10,12,16,18-19,24-26H,6,11H2,1-5H3/b8-7+/t12-,16-,18+,19+,20+,21-/m0/s1 |
| InChIKey | BTVUENFCNHCCNW-QPOFEPKDSA-N |
| XLogP | 1.42 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.46 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |