About 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine
5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine (PubChem CID 132580046) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine.
Molecular Properties
| Compound Name | 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine |
| PubChem CID | 132580046 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine |
| SMILES | CN1CCN(C)c2nnccc21 |
| InChI | InChI=1S/C8H12N4/c1-11-5-6-12(2)8-7(11)3-4-9-10-8/h3-4H,5-6H2,1-2H3 |
| InChIKey | PNLBKXDRLWDPAD-UHFFFAOYSA-N |
| XLogP | 0.36 |
| TPSA | 32.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 0.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine?
The IUPAC name of 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine (CID 132580046) is 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine.
What is the SMILES notation for 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine?
The canonical SMILES for 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine is CN1CCN(C)c2nnccc21.
What is the InChIKey of 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine?
The InChIKey is PNLBKXDRLWDPAD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-11-5-6-12(2)8-7(11)3-4-9-10-8/h3-4H,5-6H2,1-2H3.
What are the key properties of 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine?
5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine has a molecular weight of 164.21 g/mol, XLogP of 0.36, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5,8-dimethyl-6,7-dihydropyrazino[2,3-c]pyridazine is sourced from PubChem (CID 132580046), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).