C21H20F3NO3 — CID 132580068
[(1R,2R)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate (PubChem CID 132580068) has the molecular formula C21H20F3NO3 and a molecular weight of 391.39 g/mol. Its IUPAC name is [(1R,2R)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate.
| Compound Name | [(1R,2R)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate |
|---|---|
| PubChem CID | 132580068 |
| Molecular Formula | C21H20F3NO3 |
| Molecular Weight | 391.39 g/mol |
| Exact Mass | 391.14 |
| IUPAC Name | [(1R,2R)-2-phenyl-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate |
| SMILES | O=C(O[C@@H]1CCCC[C@@]1(NC(=O)C(F)(F)F)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20F3NO3/c22-21(23,24)19(27)25-20(16-11-5-2-6-12-16)14-8-7-13-17(20)28-18(26)15-9-3-1-4-10-15/h1-6,9-12,17H,7-8,13-14H2,(H,25,27)/t17-,20-/m1/s1 |
| InChIKey | SHGCWAULJAUDKZ-YLJYHZDGSA-N |
| XLogP | 4.36 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.39 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |