C22H22F3NO3 — CID 132580072
[(1R,2R)-2-(4-methylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate (PubChem CID 132580072) has the molecular formula C22H22F3NO3 and a molecular weight of 405.42 g/mol. Its IUPAC name is [(1R,2R)-2-(4-methylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate.
| Compound Name | [(1R,2R)-2-(4-methylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate |
|---|---|
| PubChem CID | 132580072 |
| Molecular Formula | C22H22F3NO3 |
| Molecular Weight | 405.42 g/mol |
| Exact Mass | 405.16 |
| IUPAC Name | [(1R,2R)-2-(4-methylphenyl)-2-[(2,2,2-trifluoroacetyl)amino]cyclohexyl] benzoate |
| SMILES | Cc1ccc([C@]2(NC(=O)C(F)(F)F)CCCC[C@H]2OC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C22H22F3NO3/c1-15-10-12-17(13-11-15)21(26-20(28)22(23,24)25)14-6-5-9-18(21)29-19(27)16-7-3-2-4-8-16/h2-4,7-8,10-13,18H,5-6,9,14H2,1H3,(H,26,28)/t18-,21-/m1/s1 |
| InChIKey | IMFFGAUXLZTFMU-WIYYLYMNSA-N |
| XLogP | 4.67 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.42 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |