C19H22N2O3 — CID 132580480
methyl (E)-3-[(6R,7R)-7-(benzylamino)-6-(hydroxymethyl)-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoate (PubChem CID 132580480) has the molecular formula C19H22N2O3 and a molecular weight of 326.40 g/mol. Its IUPAC name is methyl (E)-3-[(6R,7R)-7-(benzylamino)-6-(hydroxymethyl)-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[(6R,7R)-7-(benzylamino)-6-(hydroxymethyl)-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 132580480 |
| Molecular Formula | C19H22N2O3 |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | methyl (E)-3-[(6R,7R)-7-(benzylamino)-6-(hydroxymethyl)-6,7-dihydro-5H-pyrrolizin-3-yl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccc2n1C[C@@H](CO)[C@H]2NCc1ccccc1 |
| InChI | InChI=1S/C19H22N2O3/c1-24-18(23)10-8-16-7-9-17-19(15(13-22)12-21(16)17)20-11-14-5-3-2-4-6-14/h2-10,15,19-20,22H,11-13H2,1H3/b10-8+/t15-,19+/m0/s1 |
| InChIKey | XGLAISMHWOWPQI-YIKFPXMYSA-N |
| XLogP | 2.13 |
| TPSA | 63.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|