C19H20N2O5 — CID 132580689
benzyl (2S)-4-amino-2-[(4-methoxybenzoyl)amino]-4-oxobutanoate (PubChem CID 132580689) has the molecular formula C19H20N2O5 and a molecular weight of 356.38 g/mol. Its IUPAC name is benzyl (2S)-4-amino-2-[(4-methoxybenzoyl)amino]-4-oxobutanoate.
| Compound Name | benzyl (2S)-4-amino-2-[(4-methoxybenzoyl)amino]-4-oxobutanoate |
|---|---|
| PubChem CID | 132580689 |
| Molecular Formula | C19H20N2O5 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.14 |
| IUPAC Name | benzyl (2S)-4-amino-2-[(4-methoxybenzoyl)amino]-4-oxobutanoate |
| SMILES | COc1ccc(C(=O)N[C@@H](CC(N)=O)C(=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C19H20N2O5/c1-25-15-9-7-14(8-10-15)18(23)21-16(11-17(20)22)19(24)26-12-13-5-3-2-4-6-13/h2-10,16H,11-12H2,1H3,(H2,20,22)(H,21,23)/t16-/m0/s1 |
| InChIKey | FYGMXSPCXUHLET-INIZCTEOSA-N |
| XLogP | 1.41 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |