C16H18O6 — CID 132580937
[(9R,10E,11aS)-3-(hydroxymethyl)-6-methylidene-2,7-dioxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] acetate (PubChem CID 132580937) has the molecular formula C16H18O6 and a molecular weight of 306.31 g/mol. Its IUPAC name is [(9R,10E,11aS)-3-(hydroxymethyl)-6-methylidene-2,7-dioxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] acetate.
| Compound Name | [(9R,10E,11aS)-3-(hydroxymethyl)-6-methylidene-2,7-dioxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] acetate |
|---|---|
| PubChem CID | 132580937 |
| Molecular Formula | C16H18O6 |
| Molecular Weight | 306.31 g/mol |
| Exact Mass | 306.11 |
| IUPAC Name | [(9R,10E,11aS)-3-(hydroxymethyl)-6-methylidene-2,7-dioxo-5,8,9,11a-tetrahydro-4H-cyclodeca[b]furan-9-yl] acetate |
| SMILES | C=C1CCC2=C(CO)C(=O)O[C@H]2/C=C/[C@H](OC(C)=O)CC1=O |
| InChI | InChI=1S/C16H18O6/c1-9-3-5-12-13(8-17)16(20)22-15(12)6-4-11(7-14(9)19)21-10(2)18/h4,6,11,15,17H,1,3,5,7-8H2,2H3/b6-4+/t11-,15-/m0/s1 |
| InChIKey | PUDREQGPLHXLJQ-RBZUQTFTSA-N |
| XLogP | 1.00 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.31 |
| LogP ≤ 5 | 1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|