About methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate
methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate (PubChem CID 132581117) has the molecular formula C29H27NO2S
and a molecular weight of 453.61 g/mol. Its IUPAC name is methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate.
Molecular Properties
| Compound Name | methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate |
| PubChem CID | 132581117 |
| Molecular Formula | C29H27NO2S |
| Molecular Weight | 453.61 g/mol |
| Exact Mass | 453.18 |
| IUPAC Name | methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate |
| SMILES | COC(=O)[C@@](Sc1ccc(C)cc1)(c1ccccc1)[C@@H](Nc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C29H27NO2S/c1-22-18-20-26(21-19-22)33-29(28(31)32-2,24-14-8-4-9-15-24)27(23-12-6-3-7-13-23)30-25-16-10-5-11-17-25/h3-21,27,30H,1-2H3/t27-,29+/m0/s1 |
| InChIKey | UEAYDDRPJDIHPW-LMSSTIIKSA-N |
| XLogP | 7.01 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 453.61 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate?
The IUPAC name of methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate (CID 132581117) is methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate.
What is the SMILES notation for methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate?
The canonical SMILES for methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate is COC(=O)[C@@](Sc1ccc(C)cc1)(c1ccccc1)[C@@H](Nc1ccccc1)c1ccccc1.
What is the InChIKey of methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate?
The InChIKey is UEAYDDRPJDIHPW-LMSSTIIKSA-N. The full InChI is InChI=1S/C29H27NO2S/c1-22-18-20-26(21-19-22)33-29(28(31)32-2,24-14-8-4-9-15-24)27(23-12-6-3-7-13-23)30-25-16-10-5-11-17-25/h3-21,27,30H,1-2H3/t27-,29+/m0/s1.
What are the key properties of methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate?
methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate has a molecular weight of 453.61 g/mol, XLogP of 7.01, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2R,3S)-3-anilino-2-(4-methylphenyl)sulfanyl-2,3-diphenylpropanoate is sourced from PubChem (CID 132581117), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).