C15H30O5Si — CID 132581263
tert-butyl-dimethyl-[(3S,4R,5R,6S)-4,5,6-trimethoxy-2-methylideneoxan-3-yl]oxysilane (PubChem CID 132581263) has the molecular formula C15H30O5Si and a molecular weight of 318.49 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(3S,4R,5R,6S)-4,5,6-trimethoxy-2-methylideneoxan-3-yl]oxysilane.
| Compound Name | tert-butyl-dimethyl-[(3S,4R,5R,6S)-4,5,6-trimethoxy-2-methylideneoxan-3-yl]oxysilane |
|---|---|
| PubChem CID | 132581263 |
| Molecular Formula | C15H30O5Si |
| Molecular Weight | 318.49 g/mol |
| Exact Mass | 318.19 |
| IUPAC Name | tert-butyl-dimethyl-[(3S,4R,5R,6S)-4,5,6-trimethoxy-2-methylideneoxan-3-yl]oxysilane |
| SMILES | C=C1O[C@H](OC)[C@H](OC)[C@@H](OC)[C@@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H30O5Si/c1-10-11(20-21(8,9)15(2,3)4)12(16-5)13(17-6)14(18-7)19-10/h11-14H,1H2,2-9H3/t11-,12+,13-,14+/m1/s1 |
| InChIKey | CPRNHFFPEQIPIE-RQJABVFESA-N |
| XLogP | 2.92 |
| TPSA | 46.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.49 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|