About (6Z)-9-azido-2,6-dimethylnona-2,6-diene
(6Z)-9-azido-2,6-dimethylnona-2,6-diene (PubChem CID 132581464) has the molecular formula C11H19N3
and a molecular weight of 193.29 g/mol. Its IUPAC name is (6Z)-9-azido-2,6-dimethylnona-2,6-diene.
Molecular Properties
| Compound Name | (6Z)-9-azido-2,6-dimethylnona-2,6-diene |
| PubChem CID | 132581464 |
| Molecular Formula | C11H19N3 |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.16 |
| IUPAC Name | (6Z)-9-azido-2,6-dimethylnona-2,6-diene |
| SMILES | CC(C)=CCC/C(C)=C\CCN=[N+]=[N-] |
| InChI | InChI=1S/C11H19N3/c1-10(2)6-4-7-11(3)8-5-9-13-14-12/h6,8H,4-5,7,9H2,1-3H3/b11-8- |
| InChIKey | XYFFRSFTDVSWEJ-FLIBITNWSA-N |
| XLogP | 4.38 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (6Z)-9-azido-2,6-dimethylnona-2,6-diene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6Z)-9-azido-2,6-dimethylnona-2,6-diene?
The IUPAC name of (6Z)-9-azido-2,6-dimethylnona-2,6-diene (CID 132581464) is (6Z)-9-azido-2,6-dimethylnona-2,6-diene.
What is the SMILES notation for (6Z)-9-azido-2,6-dimethylnona-2,6-diene?
The canonical SMILES for (6Z)-9-azido-2,6-dimethylnona-2,6-diene is CC(C)=CCC/C(C)=C\CCN=[N+]=[N-].
What is the InChIKey of (6Z)-9-azido-2,6-dimethylnona-2,6-diene?
The InChIKey is XYFFRSFTDVSWEJ-FLIBITNWSA-N. The full InChI is InChI=1S/C11H19N3/c1-10(2)6-4-7-11(3)8-5-9-13-14-12/h6,8H,4-5,7,9H2,1-3H3/b11-8-.
What are the key properties of (6Z)-9-azido-2,6-dimethylnona-2,6-diene?
(6Z)-9-azido-2,6-dimethylnona-2,6-diene has a molecular weight of 193.29 g/mol, XLogP of 4.38, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (6Z)-9-azido-2,6-dimethylnona-2,6-diene is sourced from PubChem (CID 132581464), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).