C39H53NO6SSi2 — CID 132581530
2-[(2S,3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxy-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione (PubChem CID 132581530) has the molecular formula C39H53NO6SSi2 and a molecular weight of 720.09 g/mol. Its IUPAC name is 2-[(2S,3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxy-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione.
| Compound Name | 2-[(2S,3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxy-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 132581530 |
| Molecular Formula | C39H53NO6SSi2 |
| Molecular Weight | 720.09 g/mol |
| Exact Mass | 719.31 |
| IUPAC Name | 2-[(2S,3R,4R,5R,6R)-5-[tert-butyl(dimethyl)silyl]oxy-6-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-phenylmethoxy-2-phenylsulfanyloxan-3-yl]isoindole-1,3-dione |
| SMILES | CC(C)(C)[Si](C)(C)OC[C@H]1O[C@@H](Sc2ccccc2)[C@H](N2C(=O)c3ccccc3C2=O)[C@@H](OCc2ccccc2)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C39H53NO6SSi2/c1-38(2,3)48(7,8)44-26-31-33(46-49(9,10)39(4,5)6)34(43-25-27-19-13-11-14-20-27)32(37(45-31)47-28-21-15-12-16-22-28)40-35(41)29-23-17-18-24-30(29)36(40)42/h11-24,31-34,37H,25-26H2,1-10H3/t31-,32-,33+,34-,37+/m1/s1 |
| InChIKey | JRDGYCNGMAVWCD-ASFASBMHSA-N |
| XLogP | 9.17 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.09 |
| LogP ≤ 5 | 9.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|