C19H17NO4 — CID 132582339
16-hydroxy-11,12-dimethyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaen-13-one (PubChem CID 132582339) has the molecular formula C19H17NO4 and a molecular weight of 323.35 g/mol. Its IUPAC name is 16-hydroxy-11,12-dimethyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaen-13-one.
| Compound Name | 16-hydroxy-11,12-dimethyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaen-13-one |
|---|---|
| PubChem CID | 132582339 |
| Molecular Formula | C19H17NO4 |
| Molecular Weight | 323.35 g/mol |
| Exact Mass | 323.12 |
| IUPAC Name | 16-hydroxy-11,12-dimethyl-3,5-dioxa-11-azapentacyclo[10.7.1.02,6.08,20.014,19]icosa-1(20),2(6),7,14(19),15,17-hexaen-13-one |
| SMILES | CN1CCc2cc3c(c4c2C1(C)C(=O)c1cc(O)ccc1-4)OCO3 |
| InChI | InChI=1S/C19H17NO4/c1-19-16-10(5-6-20(19)2)7-14-17(24-9-23-14)15(16)12-4-3-11(21)8-13(12)18(19)22/h3-4,7-8,21H,5-6,9H2,1-2H3 |
| InChIKey | GIONINGVLGZFDK-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.35 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |