C27H58O3SSi2 — CID 132582467
S-ethyl (3R,5R,7S,9R)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,9-trimethyldecanethioate (PubChem CID 132582467) has the molecular formula C27H58O3SSi2 and a molecular weight of 519.00 g/mol. Its IUPAC name is S-ethyl (3R,5R,7S,9R)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,9-trimethyldecanethioate.
| Compound Name | S-ethyl (3R,5R,7S,9R)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,9-trimethyldecanethioate |
|---|---|
| PubChem CID | 132582467 |
| Molecular Formula | C27H58O3SSi2 |
| Molecular Weight | 519.00 g/mol |
| Exact Mass | 518.36 |
| IUPAC Name | S-ethyl (3R,5R,7S,9R)-5,10-bis[[tert-butyl(dimethyl)silyl]oxy]-3,7,9-trimethyldecanethioate |
| SMILES | CCSC(=O)C[C@H](C)C[C@@H](C[C@@H](C)C[C@@H](C)CO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C27H58O3SSi2/c1-15-31-25(28)19-22(3)18-24(30-33(13,14)27(8,9)10)17-21(2)16-23(4)20-29-32(11,12)26(5,6)7/h21-24H,15-20H2,1-14H3/t21-,22+,23+,24+/m0/s1 |
| InChIKey | ZJZMWBCZAHLAPT-OLKYXYMISA-N |
| XLogP | 9.15 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.00 |
| LogP ≤ 5 | 9.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|