C30H26ClN3O3S — CID 132582644
[11-chloro-14-(4-methylphenyl)sulfonyl-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzotriazepin-8-yl]-phenylmethanone (PubChem CID 132582644) has the molecular formula C30H26ClN3O3S and a molecular weight of 544.08 g/mol. Its IUPAC name is [11-chloro-14-(4-methylphenyl)sulfonyl-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzotriazepin-8-yl]-phenylmethanone.
| Compound Name | [11-chloro-14-(4-methylphenyl)sulfonyl-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzotriazepin-8-yl]-phenylmethanone |
|---|---|
| PubChem CID | 132582644 |
| Molecular Formula | C30H26ClN3O3S |
| Molecular Weight | 544.08 g/mol |
| Exact Mass | 543.14 |
| IUPAC Name | [11-chloro-14-(4-methylphenyl)sulfonyl-5,6,9,14a-tetrahydroisoquinolino[1,2-b][1,3,4]benzotriazepin-8-yl]-phenylmethanone |
| SMILES | Cc1ccc(S(=O)(=O)N2c3ccc(Cl)cc3CN(C(=O)c3ccccc3)N3CCc4ccccc4C32)cc1 |
| InChI | InChI=1S/C30H26ClN3O3S/c1-21-11-14-26(15-12-21)38(36,37)34-28-16-13-25(31)19-24(28)20-33(30(35)23-8-3-2-4-9-23)32-18-17-22-7-5-6-10-27(22)29(32)34/h2-16,19,29H,17-18,20H2,1H3 |
| InChIKey | GSMYRTYKXMYRNZ-UHFFFAOYSA-N |
| XLogP | 5.97 |
| TPSA | 60.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.08 |
| LogP ≤ 5 | 5.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |