C27H29NO — CID 132583299
4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol (PubChem CID 132583299) has the molecular formula C27H29NO and a molecular weight of 383.54 g/mol. Its IUPAC name is 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol.
| Compound Name | 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol |
|---|---|
| PubChem CID | 132583299 |
| Molecular Formula | C27H29NO |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol |
| SMILES | Cc1ccc2c(C)c(C(c3ccccc3)c3cc(C(C)(C)C)ccc3O)[nH]c2c1 |
| InChI | InChI=1S/C27H29NO/c1-17-11-13-21-18(2)26(28-23(21)15-17)25(19-9-7-6-8-10-19)22-16-20(27(3,4)5)12-14-24(22)29/h6-16,25,28-29H,1-5H3 |
| InChIKey | KMRWTEMBMGESNF-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |