About 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol
4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol (PubChem CID 132583299) has the molecular formula C27H29NO
and a molecular weight of 383.54 g/mol. Its IUPAC name is 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol.
Molecular Properties
| Compound Name | 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol |
| PubChem CID | 132583299 |
| Molecular Formula | C27H29NO |
| Molecular Weight | 383.54 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol |
| SMILES | Cc1ccc2c(C)c(C(c3ccccc3)c3cc(C(C)(C)C)ccc3O)[nH]c2c1 |
| InChI | InChI=1S/C27H29NO/c1-17-11-13-21-18(2)26(28-23(21)15-17)25(19-9-7-6-8-10-19)22-16-20(27(3,4)5)12-14-24(22)29/h6-16,25,28-29H,1-5H3 |
| InChIKey | KMRWTEMBMGESNF-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 36.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 383.54 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol?
The IUPAC name of 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol (CID 132583299) is 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol.
What is the SMILES notation for 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol?
The canonical SMILES for 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol is Cc1ccc2c(C)c(C(c3ccccc3)c3cc(C(C)(C)C)ccc3O)[nH]c2c1.
What is the InChIKey of 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol?
The InChIKey is KMRWTEMBMGESNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H29NO/c1-17-11-13-21-18(2)26(28-23(21)15-17)25(19-9-7-6-8-10-19)22-16-20(27(3,4)5)12-14-24(22)29/h6-16,25,28-29H,1-5H3.
What are the key properties of 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol?
4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol has a molecular weight of 383.54 g/mol, XLogP of 6.97, 3 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-[(3,6-dimethyl-1H-indol-2-yl)-phenylmethyl]phenol is sourced from PubChem (CID 132583299), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).