About 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene
4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene (PubChem CID 132583312) has the molecular formula C24H27OP
and a molecular weight of 362.45 g/mol. Its IUPAC name is 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene.
Molecular Properties
| Compound Name | 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene |
| PubChem CID | 132583312 |
| Molecular Formula | C24H27OP |
| Molecular Weight | 362.45 g/mol |
| Exact Mass | 362.18 |
| IUPAC Name | 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene |
| SMILES | Cc1cc(C)cc(P(=O)(c2cc(C)cc(C)c2)c2ccc(C)c(C)c2)c1 |
| InChI | InChI=1S/C24H27OP/c1-16-9-17(2)12-23(11-16)26(25,22-8-7-20(5)21(6)15-22)24-13-18(3)10-19(4)14-24/h7-15H,1-6H3 |
| InChIKey | KPLYGAXWYZIVMN-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 362.45 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene?
The IUPAC name of 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene (CID 132583312) is 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene.
What is the SMILES notation for 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene?
The canonical SMILES for 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene is Cc1cc(C)cc(P(=O)(c2cc(C)cc(C)c2)c2ccc(C)c(C)c2)c1.
What is the InChIKey of 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene?
The InChIKey is KPLYGAXWYZIVMN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H27OP/c1-16-9-17(2)12-23(11-16)26(25,22-8-7-20(5)21(6)15-22)24-13-18(3)10-19(4)14-24/h7-15H,1-6H3.
What are the key properties of 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene?
4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene has a molecular weight of 362.45 g/mol, XLogP of 5.18, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-bis(3,5-dimethylphenyl)phosphoryl-1,2-dimethylbenzene is sourced from PubChem (CID 132583312), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).