C16H26N6O4 — CID 132583513
8-oxa-1,11,18,21,22,23-hexazabicyclo[18.3.0]tricosa-20,22-diene-7,10,17-trione (PubChem CID 132583513) has the molecular formula C16H26N6O4 and a molecular weight of 366.42 g/mol. Its IUPAC name is 8-oxa-1,11,18,21,22,23-hexazabicyclo[18.3.0]tricosa-20,22-diene-7,10,17-trione.
| Compound Name | 8-oxa-1,11,18,21,22,23-hexazabicyclo[18.3.0]tricosa-20,22-diene-7,10,17-trione |
|---|---|
| PubChem CID | 132583513 |
| Molecular Formula | C16H26N6O4 |
| Molecular Weight | 366.42 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | 8-oxa-1,11,18,21,22,23-hexazabicyclo[18.3.0]tricosa-20,22-diene-7,10,17-trione |
| SMILES | O=C1CCCCCNC(=O)COC(=O)CCCCCn2nnnc2CN1 |
| InChI | InChI=1S/C16H26N6O4/c23-14-7-3-1-5-9-17-15(24)12-26-16(25)8-4-2-6-10-22-13(11-18-14)19-20-21-22/h1-12H2,(H,17,24)(H,18,23) |
| InChIKey | QJRXDFWFGDLGEX-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.42 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |