C22H30N6O4 — CID 132583518
9-phenyl-8-oxa-1,11,18,21,22,23-hexazabicyclo[18.3.0]tricosa-20,22-diene-7,10,17-trione (PubChem CID 132583518) has the molecular formula C22H30N6O4 and a molecular weight of 442.52 g/mol. Its IUPAC name is 9-phenyl-8-oxa-1,11,18,21,22,23-hexazabicyclo[18.3.0]tricosa-20,22-diene-7,10,17-trione.
| Compound Name | 9-phenyl-8-oxa-1,11,18,21,22,23-hexazabicyclo[18.3.0]tricosa-20,22-diene-7,10,17-trione |
|---|---|
| PubChem CID | 132583518 |
| Molecular Formula | C22H30N6O4 |
| Molecular Weight | 442.52 g/mol |
| Exact Mass | 442.23 |
| IUPAC Name | 9-phenyl-8-oxa-1,11,18,21,22,23-hexazabicyclo[18.3.0]tricosa-20,22-diene-7,10,17-trione |
| SMILES | O=C1CCCCCNC(=O)C(c2ccccc2)OC(=O)CCCCCn2nnnc2CN1 |
| InChI | InChI=1S/C22H30N6O4/c29-19-12-6-2-8-14-23-22(31)21(17-10-4-1-5-11-17)32-20(30)13-7-3-9-15-28-18(16-24-19)25-26-27-28/h1,4-5,10-11,21H,2-3,6-9,12-16H2,(H,23,31)(H,24,29) |
| InChIKey | VHOTVVSWDFRCKZ-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 128.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.52 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |