About ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate
ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate (PubChem CID 132583779) has the molecular formula C17H22F2N2O3
and a molecular weight of 340.37 g/mol. Its IUPAC name is ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate.
Molecular Properties
| Compound Name | ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate |
| PubChem CID | 132583779 |
| Molecular Formula | C17H22F2N2O3 |
| Molecular Weight | 340.37 g/mol |
| Exact Mass | 340.16 |
| IUPAC Name | ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate |
| SMILES | CCOC(=O)C(F)(F)/C(=N/N1CCOCC1)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C17H22F2N2O3/c1-4-24-16(22)17(18,19)15(20-21-7-9-23-10-8-21)14-6-5-12(2)13(3)11-14/h5-6,11H,4,7-10H2,1-3H3/b20-15+ |
| InChIKey | NCQQHWYTKLJWHM-HMMYKYKNSA-N |
| XLogP | 2.54 |
| TPSA | 51.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.37 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate?
The IUPAC name of ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate (CID 132583779) is ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate.
What is the SMILES notation for ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate?
The canonical SMILES for ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate is CCOC(=O)C(F)(F)/C(=N/N1CCOCC1)c1ccc(C)c(C)c1.
What is the InChIKey of ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate?
The InChIKey is NCQQHWYTKLJWHM-HMMYKYKNSA-N. The full InChI is InChI=1S/C17H22F2N2O3/c1-4-24-16(22)17(18,19)15(20-21-7-9-23-10-8-21)14-6-5-12(2)13(3)11-14/h5-6,11H,4,7-10H2,1-3H3/b20-15+.
What are the key properties of ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate?
ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate has a molecular weight of 340.37 g/mol, XLogP of 2.54, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (3E)-3-(3,4-dimethylphenyl)-2,2-difluoro-3-morpholin-4-yliminopropanoate is sourced from PubChem (CID 132583779), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).