C22H24N2O3 — CID 132584044
butyl (3R,4R)-3-(1H-indol-3-yl)-2-phenyl-1,2-oxazolidine-4-carboxylate (PubChem CID 132584044) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is butyl (3R,4R)-3-(1H-indol-3-yl)-2-phenyl-1,2-oxazolidine-4-carboxylate.
| Compound Name | butyl (3R,4R)-3-(1H-indol-3-yl)-2-phenyl-1,2-oxazolidine-4-carboxylate |
|---|---|
| PubChem CID | 132584044 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | butyl (3R,4R)-3-(1H-indol-3-yl)-2-phenyl-1,2-oxazolidine-4-carboxylate |
| SMILES | CCCCOC(=O)[C@H]1CON(c2ccccc2)[C@H]1c1c[nH]c2ccccc12 |
| InChI | InChI=1S/C22H24N2O3/c1-2-3-13-26-22(25)19-15-27-24(16-9-5-4-6-10-16)21(19)18-14-23-20-12-8-7-11-17(18)20/h4-12,14,19,21,23H,2-3,13,15H2,1H3/t19-,21-/m0/s1 |
| InChIKey | GJEKOZFJWZSLRR-FPOVZHCZSA-N |
| XLogP | 4.62 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|