About (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one
(5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one (PubChem CID 132584292) has the molecular formula C21H19NO3
and a molecular weight of 333.39 g/mol. Its IUPAC name is (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one.
Molecular Properties
| Compound Name | (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one |
| PubChem CID | 132584292 |
| Molecular Formula | C21H19NO3 |
| Molecular Weight | 333.39 g/mol |
| Exact Mass | 333.14 |
| IUPAC Name | (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one |
| SMILES | CCN1C(=O)C2(C=C/C(=C/c3ccccc3)O2)c2c(OC)cccc21 |
| InChI | InChI=1S/C21H19NO3/c1-3-22-17-10-7-11-18(24-2)19(17)21(20(22)23)13-12-16(25-21)14-15-8-5-4-6-9-15/h4-14H,3H2,1-2H3/b16-14- |
| InChIKey | ADBRZQFMBRRFJE-PEZBUJJGSA-N |
| XLogP | 3.88 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.39 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one?
The IUPAC name of (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one (CID 132584292) is (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one.
What is the SMILES notation for (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one?
The canonical SMILES for (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one is CCN1C(=O)C2(C=C/C(=C/c3ccccc3)O2)c2c(OC)cccc21.
What is the InChIKey of (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one?
The InChIKey is ADBRZQFMBRRFJE-PEZBUJJGSA-N. The full InChI is InChI=1S/C21H19NO3/c1-3-22-17-10-7-11-18(24-2)19(17)21(20(22)23)13-12-16(25-21)14-15-8-5-4-6-9-15/h4-14H,3H2,1-2H3/b16-14-.
What are the key properties of (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one?
(5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one has a molecular weight of 333.39 g/mol, XLogP of 3.88, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5Z)-5-benzylidene-1'-ethyl-4'-methoxyspiro[furan-2,3'-indole]-2'-one is sourced from PubChem (CID 132584292), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).