C13H19N2O+ — CID 13258455
8,13-dimethyl-1-aza-8-azoniatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one (PubChem CID 13258455) has the molecular formula C13H19N2O+ and a molecular weight of 219.31 g/mol. Its IUPAC name is 8,13-dimethyl-1-aza-8-azoniatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one.
| Compound Name | 8,13-dimethyl-1-aza-8-azoniatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one |
|---|---|
| PubChem CID | 13258455 |
| Molecular Formula | C13H19N2O+ |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.15 |
| IUPAC Name | 8,13-dimethyl-1-aza-8-azoniatricyclo[7.4.0.03,7]trideca-3(7),8-dien-2-one |
| SMILES | CC1CCCc2n1c(=O)c1c([n+]2C)CCC1 |
| InChI | InChI=1S/C13H19N2O/c1-9-5-3-8-12-14(2)11-7-4-6-10(11)13(16)15(9)12/h9H,3-8H2,1-2H3/q+1 |
| InChIKey | BCYKGRNAPMOOGV-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 25.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|