About 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one
4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one (PubChem CID 132585295) has the molecular formula C7H12N4O2S
and a molecular weight of 216.27 g/mol. Its IUPAC name is 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one.
Molecular Properties
| Compound Name | 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| PubChem CID | 132585295 |
| Molecular Formula | C7H12N4O2S |
| Molecular Weight | 216.27 g/mol |
| Exact Mass | 216.07 |
| IUPAC Name | 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one |
| SMILES | CC(C)(CO)c1n[nH]c(=S)n(N)c1=O |
| InChI | InChI=1S/C7H12N4O2S/c1-7(2,3-12)4-5(13)11(8)6(14)10-9-4/h12H,3,8H2,1-2H3,(H,10,14) |
| InChIKey | MQCJJFGJFPETLN-UHFFFAOYSA-N |
| XLogP | -0.72 |
| TPSA | 96.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.27 |
| LogP ≤ 5 | -0.72 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one?
The IUPAC name of 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one (CID 132585295) is 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one.
What is the SMILES notation for 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one?
The canonical SMILES for 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one is CC(C)(CO)c1n[nH]c(=S)n(N)c1=O.
What is the InChIKey of 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one?
The InChIKey is MQCJJFGJFPETLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H12N4O2S/c1-7(2,3-12)4-5(13)11(8)6(14)10-9-4/h12H,3,8H2,1-2H3,(H,10,14).
What are the key properties of 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one?
4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one has a molecular weight of 216.27 g/mol, XLogP of -0.72, 2 rotatable bonds, 3 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-6-(1-hydroxy-2-methylpropan-2-yl)-3-sulfanylidene-2H-1,2,4-triazin-5-one is sourced from PubChem (CID 132585295), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).