C17H16N2 — CID 13258584
4,5-dimethyl-1,3-diphenylpyrazole (PubChem CID 13258584) has the molecular formula C17H16N2 and a molecular weight of 248.33 g/mol. Its IUPAC name is 4,5-dimethyl-1,3-diphenylpyrazole.
| Compound Name | 4,5-dimethyl-1,3-diphenylpyrazole |
|---|---|
| PubChem CID | 13258584 |
| Molecular Formula | C17H16N2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 4,5-dimethyl-1,3-diphenylpyrazole |
| SMILES | Cc1c(-c2ccccc2)nn(-c2ccccc2)c1C |
| InChI | InChI=1S/C17H16N2/c1-13-14(2)19(16-11-7-4-8-12-16)18-17(13)15-9-5-3-6-10-15/h3-12H,1-2H3 |
| InChIKey | QFEKFWDCGMZLMN-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |