About ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate
ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate (PubChem CID 132586254) has the molecular formula C10H12F3N3O3
and a molecular weight of 279.22 g/mol. Its IUPAC name is ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate.
Molecular Properties
| Compound Name | ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate |
| PubChem CID | 132586254 |
| Molecular Formula | C10H12F3N3O3 |
| Molecular Weight | 279.22 g/mol |
| Exact Mass | 279.08 |
| IUPAC Name | ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate |
| SMILES | CCOC(=O)CC(n1cc(C(N)=O)cn1)C(F)(F)F |
| InChI | InChI=1S/C10H12F3N3O3/c1-2-19-8(17)3-7(10(11,12)13)16-5-6(4-15-16)9(14)18/h4-5,7H,2-3H2,1H3,(H2,14,18) |
| InChIKey | YTLPXZYMNNWXHX-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 279.22 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate?
The IUPAC name of ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate (CID 132586254) is ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate.
What is the SMILES notation for ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate?
The canonical SMILES for ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate is CCOC(=O)CC(n1cc(C(N)=O)cn1)C(F)(F)F.
What is the InChIKey of ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate?
The InChIKey is YTLPXZYMNNWXHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12F3N3O3/c1-2-19-8(17)3-7(10(11,12)13)16-5-6(4-15-16)9(14)18/h4-5,7H,2-3H2,1H3,(H2,14,18).
What are the key properties of ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate?
ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate has a molecular weight of 279.22 g/mol, XLogP of 1.04, 5 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-(4-carbamoylpyrazol-1-yl)-4,4,4-trifluorobutanoate is sourced from PubChem (CID 132586254), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).