C11H8Cl2N2O2S — CID 132587371
methyl 2-(6,8-dichloroquinazolin-4-yl)sulfanylacetate (PubChem CID 132587371) has the molecular formula C11H8Cl2N2O2S and a molecular weight of 303.17 g/mol. Its IUPAC name is methyl 2-(6,8-dichloroquinazolin-4-yl)sulfanylacetate.
| Compound Name | methyl 2-(6,8-dichloroquinazolin-4-yl)sulfanylacetate |
|---|---|
| PubChem CID | 132587371 |
| Molecular Formula | C11H8Cl2N2O2S |
| Molecular Weight | 303.17 g/mol |
| Exact Mass | 301.97 |
| IUPAC Name | methyl 2-(6,8-dichloroquinazolin-4-yl)sulfanylacetate |
| SMILES | COC(=O)CSc1ncnc2c(Cl)cc(Cl)cc12 |
| InChI | InChI=1S/C11H8Cl2N2O2S/c1-17-9(16)4-18-11-7-2-6(12)3-8(13)10(7)14-5-15-11/h2-3,5H,4H2,1H3 |
| InChIKey | RPFZECRGPSSJSI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.17 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |