C21H31NO2Si — CID 13258743
1-benzyl-5-ethoxy-3-(5-trimethylsilylpent-3-ynyl)pyrrolidin-2-one (PubChem CID 13258743) has the molecular formula C21H31NO2Si and a molecular weight of 357.57 g/mol. Its IUPAC name is 1-benzyl-5-ethoxy-3-(5-trimethylsilylpent-3-ynyl)pyrrolidin-2-one.
| Compound Name | 1-benzyl-5-ethoxy-3-(5-trimethylsilylpent-3-ynyl)pyrrolidin-2-one |
|---|---|
| PubChem CID | 13258743 |
| Molecular Formula | C21H31NO2Si |
| Molecular Weight | 357.57 g/mol |
| Exact Mass | 357.21 |
| IUPAC Name | 1-benzyl-5-ethoxy-3-(5-trimethylsilylpent-3-ynyl)pyrrolidin-2-one |
| SMILES | CCOC1CC(CCC#CC[Si](C)(C)C)C(=O)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H31NO2Si/c1-5-24-20-16-19(14-10-7-11-15-25(2,3)4)21(23)22(20)17-18-12-8-6-9-13-18/h6,8-9,12-13,19-20H,5,10,14-17H2,1-4H3 |
| InChIKey | NFRSBWJIPLKZRW-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.57 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|