About 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde
3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde (PubChem CID 132588612) has the molecular formula C11H8BrNO2
and a molecular weight of 266.09 g/mol. Its IUPAC name is 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde.
Molecular Properties
| Compound Name | 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde |
| PubChem CID | 132588612 |
| Molecular Formula | C11H8BrNO2 |
| Molecular Weight | 266.09 g/mol |
| Exact Mass | 264.97 |
| IUPAC Name | 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde |
| SMILES | Cc1cc(Br)ccc1-c1nocc1C=O |
| InChI | InChI=1S/C11H8BrNO2/c1-7-4-9(12)2-3-10(7)11-8(5-14)6-15-13-11/h2-6H,1H3 |
| InChIKey | IHYGFOZXQDRQNG-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 266.09 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde?
The IUPAC name of 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde (CID 132588612) is 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde.
What is the SMILES notation for 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde?
The canonical SMILES for 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde is Cc1cc(Br)ccc1-c1nocc1C=O.
What is the InChIKey of 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde?
The InChIKey is IHYGFOZXQDRQNG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H8BrNO2/c1-7-4-9(12)2-3-10(7)11-8(5-14)6-15-13-11/h2-6H,1H3.
What are the key properties of 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde?
3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde has a molecular weight of 266.09 g/mol, XLogP of 3.23, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(4-bromo-2-methylphenyl)-1,2-oxazole-4-carbaldehyde is sourced from PubChem (CID 132588612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).