C11H13ClF3N — CID 132588716
3-(2-chlorophenyl)-1,1,1-trifluoro-3-methylbutan-2-amine (PubChem CID 132588716) has the molecular formula C11H13ClF3N and a molecular weight of 251.68 g/mol. Its IUPAC name is 3-(2-chlorophenyl)-1,1,1-trifluoro-3-methylbutan-2-amine.
| Compound Name | 3-(2-chlorophenyl)-1,1,1-trifluoro-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 132588716 |
| Molecular Formula | C11H13ClF3N |
| Molecular Weight | 251.68 g/mol |
| Exact Mass | 251.07 |
| IUPAC Name | 3-(2-chlorophenyl)-1,1,1-trifluoro-3-methylbutan-2-amine |
| SMILES | CC(C)(c1ccccc1Cl)C(N)C(F)(F)F |
| InChI | InChI=1S/C11H13ClF3N/c1-10(2,9(16)11(13,14)15)7-5-3-4-6-8(7)12/h3-6,9H,16H2,1-2H3 |
| InChIKey | VPXVKDAQJLNMIQ-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.68 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |