C14H20BrN — CID 132589602
8-bromo-2-tert-butyl-6-methyl-1,2,3,4-tetrahydroquinoline (PubChem CID 132589602) has the molecular formula C14H20BrN and a molecular weight of 282.22 g/mol. Its IUPAC name is 8-bromo-2-tert-butyl-6-methyl-1,2,3,4-tetrahydroquinoline.
| Compound Name | 8-bromo-2-tert-butyl-6-methyl-1,2,3,4-tetrahydroquinoline |
|---|---|
| PubChem CID | 132589602 |
| Molecular Formula | C14H20BrN |
| Molecular Weight | 282.22 g/mol |
| Exact Mass | 281.08 |
| IUPAC Name | 8-bromo-2-tert-butyl-6-methyl-1,2,3,4-tetrahydroquinoline |
| SMILES | Cc1cc(Br)c2c(c1)CCC(C(C)(C)C)N2 |
| InChI | InChI=1S/C14H20BrN/c1-9-7-10-5-6-12(14(2,3)4)16-13(10)11(15)8-9/h7-8,12,16H,5-6H2,1-4H3 |
| InChIKey | WWGULMZKJZJBJX-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.22 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |