C15H13ClN2O3S — CID 132590880
3-(3-chloro-4-ethoxyphenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide (PubChem CID 132590880) has the molecular formula C15H13ClN2O3S and a molecular weight of 336.80 g/mol. Its IUPAC name is 3-(3-chloro-4-ethoxyphenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide.
| Compound Name | 3-(3-chloro-4-ethoxyphenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
|---|---|
| PubChem CID | 132590880 |
| Molecular Formula | C15H13ClN2O3S |
| Molecular Weight | 336.80 g/mol |
| Exact Mass | 336.03 |
| IUPAC Name | 3-(3-chloro-4-ethoxyphenyl)-4H-1λ6,2,4-benzothiadiazine 1,1-dioxide |
| SMILES | CCOc1ccc(C2=NS(=O)(=O)c3ccccc3N2)cc1Cl |
| InChI | InChI=1S/C15H13ClN2O3S/c1-2-21-13-8-7-10(9-11(13)16)15-17-12-5-3-4-6-14(12)22(19,20)18-15/h3-9H,2H2,1H3,(H,17,18) |
| InChIKey | FBEAYNMKAUERFQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 67.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.80 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |