About 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one
1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one (PubChem CID 13259301) has the molecular formula C13H10ClN3O
and a molecular weight of 259.70 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one |
| PubChem CID | 13259301 |
| Molecular Formula | C13H10ClN3O |
| Molecular Weight | 259.70 g/mol |
| Exact Mass | 259.05 |
| IUPAC Name | 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one |
| SMILES | O=C1NCc2cccnc2N1c1ccc(Cl)cc1 |
| InChI | InChI=1S/C13H10ClN3O/c14-10-3-5-11(6-4-10)17-12-9(2-1-7-15-12)8-16-13(17)18/h1-7H,8H2,(H,16,18) |
| InChIKey | BVAPQRBJGLJDRN-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 259.70 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one?
The IUPAC name of 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one (CID 13259301) is 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one.
What is the SMILES notation for 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one?
The canonical SMILES for 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one is O=C1NCc2cccnc2N1c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one?
The InChIKey is BVAPQRBJGLJDRN-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10ClN3O/c14-10-3-5-11(6-4-10)17-12-9(2-1-7-15-12)8-16-13(17)18/h1-7H,8H2,(H,16,18).
What are the key properties of 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one?
1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one has a molecular weight of 259.70 g/mol, XLogP of 3.10, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-3,4-dihydropyrido[2,3-d]pyrimidin-2-one is sourced from PubChem (CID 13259301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).