C15H13IN4O — CID 132593252
5-[3-iodo-4-[(2-methylphenyl)methoxy]phenyl]-2H-tetrazole (PubChem CID 132593252) has the molecular formula C15H13IN4O and a molecular weight of 392.20 g/mol. Its IUPAC name is 5-[3-iodo-4-[(2-methylphenyl)methoxy]phenyl]-2H-tetrazole.
| Compound Name | 5-[3-iodo-4-[(2-methylphenyl)methoxy]phenyl]-2H-tetrazole |
|---|---|
| PubChem CID | 132593252 |
| Molecular Formula | C15H13IN4O |
| Molecular Weight | 392.20 g/mol |
| Exact Mass | 392.01 |
| IUPAC Name | 5-[3-iodo-4-[(2-methylphenyl)methoxy]phenyl]-2H-tetrazole |
| SMILES | Cc1ccccc1COc1ccc(-c2nn[nH]n2)cc1I |
| InChI | InChI=1S/C15H13IN4O/c1-10-4-2-3-5-12(10)9-21-14-7-6-11(8-13(14)16)15-17-19-20-18-15/h2-8H,9H2,1H3,(H,17,18,19,20) |
| InChIKey | DYTGRHKYPRNSLT-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.20 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|