C9H16N2O3 — CID 132594065
3-(oxolan-2-ylmethylamino)azetidine-3-carboxylic acid (PubChem CID 132594065) has the molecular formula C9H16N2O3 and a molecular weight of 200.24 g/mol. Its IUPAC name is 3-(oxolan-2-ylmethylamino)azetidine-3-carboxylic acid.
| Compound Name | 3-(oxolan-2-ylmethylamino)azetidine-3-carboxylic acid |
|---|---|
| PubChem CID | 132594065 |
| Molecular Formula | C9H16N2O3 |
| Molecular Weight | 200.24 g/mol |
| Exact Mass | 200.12 |
| IUPAC Name | 3-(oxolan-2-ylmethylamino)azetidine-3-carboxylic acid |
| SMILES | O=C(O)C1(NCC2CCCO2)CNC1 |
| InChI | InChI=1S/C9H16N2O3/c12-8(13)9(5-10-6-9)11-4-7-2-1-3-14-7/h7,10-11H,1-6H2,(H,12,13) |
| InChIKey | NRMJBXMCLNSVIU-UHFFFAOYSA-N |
| XLogP | -0.82 |
| TPSA | 70.59 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.24 |
| LogP ≤ 5 | -0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |