C23H38O3 — CID 132594785
(2S,3S,5R,6R)-2-hydroxy-2,5-dimethyl-3-(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)-6-(2-methylpropanoyl)cyclohexan-1-one (PubChem CID 132594785) has the molecular formula C23H38O3 and a molecular weight of 362.55 g/mol. Its IUPAC name is (2S,3S,5R,6R)-2-hydroxy-2,5-dimethyl-3-(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)-6-(2-methylpropanoyl)cyclohexan-1-one.
| Compound Name | (2S,3S,5R,6R)-2-hydroxy-2,5-dimethyl-3-(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)-6-(2-methylpropanoyl)cyclohexan-1-one |
|---|---|
| PubChem CID | 132594785 |
| Molecular Formula | C23H38O3 |
| Molecular Weight | 362.55 g/mol |
| Exact Mass | 362.28 |
| IUPAC Name | (2S,3S,5R,6R)-2-hydroxy-2,5-dimethyl-3-(3-methylbut-2-enyl)-5-(4-methylpent-3-enyl)-6-(2-methylpropanoyl)cyclohexan-1-one |
| SMILES | CC(C)=CCC[C@]1(C)C[C@H](CC=C(C)C)[C@](C)(O)C(=O)[C@H]1C(=O)C(C)C |
| InChI | InChI=1S/C23H38O3/c1-15(2)10-9-13-22(7)14-18(12-11-16(3)4)23(8,26)21(25)19(22)20(24)17(5)6/h10-11,17-19,26H,9,12-14H2,1-8H3/t18-,19+,22+,23-/m0/s1 |
| InChIKey | BJOJGRRRDZLIFP-CSGUBPAMSA-N |
| XLogP | 5.28 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.55 |
| LogP ≤ 5 | 5.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|