C27H48O4Si — CID 132594869
2-[(2R,3aS,8S,9R,9aS)-2-methoxy-2,8-dimethyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-9-yl]ethoxy-tert-butyl-dimethylsilane (PubChem CID 132594869) has the molecular formula C27H48O4Si and a molecular weight of 464.76 g/mol. Its IUPAC name is 2-[(2R,3aS,8S,9R,9aS)-2-methoxy-2,8-dimethyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-9-yl]ethoxy-tert-butyl-dimethylsilane.
| Compound Name | 2-[(2R,3aS,8S,9R,9aS)-2-methoxy-2,8-dimethyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-9-yl]ethoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 132594869 |
| Molecular Formula | C27H48O4Si |
| Molecular Weight | 464.76 g/mol |
| Exact Mass | 464.33 |
| IUPAC Name | 2-[(2R,3aS,8S,9R,9aS)-2-methoxy-2,8-dimethyl-8-(4-methylpent-3-enyl)-3a,5,7,9-tetrahydro-3H-furo[2,3-i][2]benzofuran-9-yl]ethoxy-tert-butyl-dimethylsilane |
| SMILES | CO[C@@]1(C)C[C@@H]2OCC3=CC[C@](C)(CCC=C(C)C)[C@@H](CCO[Si](C)(C)C(C)(C)C)[C@]32O1 |
| InChI | InChI=1S/C27H48O4Si/c1-20(2)12-11-15-25(6)16-13-21-19-29-23-18-26(7,28-8)31-27(21,23)22(25)14-17-30-32(9,10)24(3,4)5/h12-13,22-23H,11,14-19H2,1-10H3/t22-,23+,25+,26-,27-/m1/s1 |
| InChIKey | BUJINRIFEXWHAQ-BDYXOVRASA-N |
| XLogP | 7.02 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.76 |
| LogP ≤ 5 | 7.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|