C26H20O3S3 — CID 132595182
S-[13,16-bis(acetylsulfanyl)-3-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaenyl] ethanethioate (PubChem CID 132595182) has the molecular formula C26H20O3S3 and a molecular weight of 476.64 g/mol. Its IUPAC name is S-[13,16-bis(acetylsulfanyl)-3-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaenyl] ethanethioate.
| Compound Name | S-[13,16-bis(acetylsulfanyl)-3-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaenyl] ethanethioate |
|---|---|
| PubChem CID | 132595182 |
| Molecular Formula | C26H20O3S3 |
| Molecular Weight | 476.64 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | S-[13,16-bis(acetylsulfanyl)-3-pentacyclo[6.6.6.02,7.09,14.015,20]icosa-2(7),3,5,9(14),10,12,15(20),16,18-nonaenyl] ethanethioate |
| SMILES | CC(=O)Sc1cccc2c1C1c3c(SC(C)=O)cccc3C2c2cccc(SC(C)=O)c21 |
| InChI | InChI=1S/C26H20O3S3/c1-13(27)30-19-10-4-7-16-22-17-8-5-11-20(31-14(2)28)24(17)26(23(16)19)25-18(22)9-6-12-21(25)32-15(3)29/h4-12,22,26H,1-3H3 |
| InChIKey | XMJXGHOYQGXELK-UHFFFAOYSA-N |
| XLogP | 6.59 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.64 |
| LogP ≤ 5 | 6.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|