C23H28IN3O5 — CID 132595450
tert-butyl N-[2-[[(2R)-1-(2-iodo-5-phenylmethoxyanilino)-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamate (PubChem CID 132595450) has the molecular formula C23H28IN3O5 and a molecular weight of 553.40 g/mol. Its IUPAC name is tert-butyl N-[2-[[(2R)-1-(2-iodo-5-phenylmethoxyanilino)-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamate.
| Compound Name | tert-butyl N-[2-[[(2R)-1-(2-iodo-5-phenylmethoxyanilino)-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamate |
|---|---|
| PubChem CID | 132595450 |
| Molecular Formula | C23H28IN3O5 |
| Molecular Weight | 553.40 g/mol |
| Exact Mass | 553.11 |
| IUPAC Name | tert-butyl N-[2-[[(2R)-1-(2-iodo-5-phenylmethoxyanilino)-1-oxopropan-2-yl]amino]-2-oxoethyl]carbamate |
| SMILES | C[C@@H](NC(=O)CNC(=O)OC(C)(C)C)C(=O)Nc1cc(OCc2ccccc2)ccc1I |
| InChI | InChI=1S/C23H28IN3O5/c1-15(26-20(28)13-25-22(30)32-23(2,3)4)21(29)27-19-12-17(10-11-18(19)24)31-14-16-8-6-5-7-9-16/h5-12,15H,13-14H2,1-4H3,(H,25,30)(H,26,28)(H,27,29)/t15-/m1/s1 |
| InChIKey | MBYYUSSGEYTMEC-OAHLLOKOSA-N |
| XLogP | 3.84 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|