C9H8F11O4S- — CID 132595460
3-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)propane-1-sulfonate (PubChem CID 132595460) has the molecular formula C9H8F11O4S- and a molecular weight of 421.20 g/mol. Its IUPAC name is 3-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)propane-1-sulfonate.
| Compound Name | 3-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)propane-1-sulfonate |
|---|---|
| PubChem CID | 132595460 |
| Molecular Formula | C9H8F11O4S- |
| Molecular Weight | 421.20 g/mol |
| Exact Mass | 421.00 |
| IUPAC Name | 3-(2,2,3,3,4,4,5,5,6,6,6-undecafluorohexoxy)propane-1-sulfonate |
| SMILES | O=S(=O)([O-])CCCOCC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C9H9F11O4S/c10-5(11,4-24-2-1-3-25(21,22)23)6(12,13)7(14,15)8(16,17)9(18,19)20/h1-4H2,(H,21,22,23)/p-1 |
| InChIKey | ZXZHOZOVYMWTNR-UHFFFAOYSA-M |
| XLogP | 3.04 |
| TPSA | 66.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|