C30H30F10O2S2 — CID 132595503
2,7-bis(7,7,8,8,8-pentafluorooctoxy)-[1]benzothiolo[3,2-b][1]benzothiole (PubChem CID 132595503) has the molecular formula C30H30F10O2S2 and a molecular weight of 676.68 g/mol. Its IUPAC name is 2,7-bis(7,7,8,8,8-pentafluorooctoxy)-[1]benzothiolo[3,2-b][1]benzothiole.
| Compound Name | 2,7-bis(7,7,8,8,8-pentafluorooctoxy)-[1]benzothiolo[3,2-b][1]benzothiole |
|---|---|
| PubChem CID | 132595503 |
| Molecular Formula | C30H30F10O2S2 |
| Molecular Weight | 676.68 g/mol |
| Exact Mass | 676.15 |
| IUPAC Name | 2,7-bis(7,7,8,8,8-pentafluorooctoxy)-[1]benzothiolo[3,2-b][1]benzothiole |
| SMILES | FC(F)(F)C(F)(F)CCCCCCOc1ccc2c(c1)sc1c3ccc(OCCCCCCC(F)(F)C(F)(F)F)cc3sc21 |
| InChI | InChI=1S/C30H30F10O2S2/c31-27(32,29(35,36)37)13-5-1-3-7-15-41-19-9-11-21-23(17-19)43-26-22-12-10-20(18-24(22)44-25(21)26)42-16-8-4-2-6-14-28(33,34)30(38,39)40/h9-12,17-18H,1-8,13-16H2 |
| InChIKey | UFNFVOHJGZETBN-UHFFFAOYSA-N |
| XLogP | 12.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 676.68 |
| LogP ≤ 5 | 12.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|