C21H30O8 — CID 132595735
(1R,2S,8S,11S,12S)-14,14-dimethyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one (PubChem CID 132595735) has the molecular formula C21H30O8 and a molecular weight of 410.46 g/mol. Its IUPAC name is (1R,2S,8S,11S,12S)-14,14-dimethyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one.
| Compound Name | (1R,2S,8S,11S,12S)-14,14-dimethyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one |
|---|---|
| PubChem CID | 132595735 |
| Molecular Formula | C21H30O8 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (1R,2S,8S,11S,12S)-14,14-dimethyl-2-[(2R,3R,4S,5S,6R)-3,4,5-trihydroxy-6-(hydroxymethyl)oxan-2-yl]oxy-6-oxatetracyclo[9.2.1.04,12.08,12]tetradec-3-en-5-one |
| SMILES | CC1(C)[C@H]2C[C@@]34C(=C[C@@H]2O[C@@H]2O[C@H](CO)[C@@H](O)[C@H](O)[C@H]2O)C(=O)OC[C@H]3CC[C@@H]14 |
| InChI | InChI=1S/C21H30O8/c1-20(2)11-6-21-9(3-4-14(20)21)8-27-18(26)10(21)5-12(11)28-19-17(25)16(24)15(23)13(7-22)29-19/h5,9,11-17,19,22-25H,3-4,6-8H2,1-2H3/t9-,11+,12+,13-,14+,15-,16+,17-,19-,21+/m1/s1 |
| InChIKey | ICDHDGZUAXXZOZ-ZKEGSQHWSA-N |
| XLogP | -0.27 |
| TPSA | 125.68 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | -0.27 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |