About 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol
4-amino-3-(pentafluoro-λ6-sulfanyl)phenol (PubChem CID 132595966) has the molecular formula C6H6F5NOS
and a molecular weight of 235.18 g/mol. Its IUPAC name is 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol.
Molecular Properties
| Compound Name | 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol |
| PubChem CID | 132595966 |
| Molecular Formula | C6H6F5NOS |
| Molecular Weight | 235.18 g/mol |
| Exact Mass | 235.01 |
| IUPAC Name | 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol |
| SMILES | Nc1ccc(O)cc1S(F)(F)(F)(F)F |
| InChI | InChI=1S/C6H6F5NOS/c7-14(8,9,10,11)6-3-4(13)1-2-5(6)12/h1-3,13H,12H2 |
| InChIKey | GUKNTOKKWLBKNF-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 235.18 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|
Analyze 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol?
The IUPAC name of 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol (CID 132595966) is 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol.
What is the SMILES notation for 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol?
The canonical SMILES for 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol is Nc1ccc(O)cc1S(F)(F)(F)(F)F.
What is the InChIKey of 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol?
The InChIKey is GUKNTOKKWLBKNF-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H6F5NOS/c7-14(8,9,10,11)6-3-4(13)1-2-5(6)12/h1-3,13H,12H2.
What are the key properties of 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol?
4-amino-3-(pentafluoro-λ6-sulfanyl)phenol has a molecular weight of 235.18 g/mol, XLogP of 3.63, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(pentafluoro-λ6-sulfanyl)phenol is sourced from PubChem (CID 132595966), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).