C20H42O4Si — CID 132596000
(3S,4R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4,8-dimethyldec-9-en-1-ol (PubChem CID 132596000) has the molecular formula C20H42O4Si and a molecular weight of 374.64 g/mol. Its IUPAC name is (3S,4R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4,8-dimethyldec-9-en-1-ol.
| Compound Name | (3S,4R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4,8-dimethyldec-9-en-1-ol |
|---|---|
| PubChem CID | 132596000 |
| Molecular Formula | C20H42O4Si |
| Molecular Weight | 374.64 g/mol |
| Exact Mass | 374.29 |
| IUPAC Name | (3S,4R,7S,8S)-7-[tert-butyl(dimethyl)silyl]oxy-3-(methoxymethoxy)-4,8-dimethyldec-9-en-1-ol |
| SMILES | C=C[C@H](C)[C@H](CC[C@@H](C)[C@H](CCO)OCOC)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O4Si/c1-10-16(2)19(24-25(8,9)20(4,5)6)12-11-17(3)18(13-14-21)23-15-22-7/h10,16-19,21H,1,11-15H2,2-9H3/t16-,17+,18-,19-/m0/s1 |
| InChIKey | ZVEDKXILUIYFOE-RDGPPVDQSA-N |
| XLogP | 4.99 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.64 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|