C21H20N2 — CID 132596105
(2S,3R)-2-benzyl-3-phenyl-1,2,3,4-tetrahydroquinoxaline (PubChem CID 132596105) has the molecular formula C21H20N2 and a molecular weight of 300.41 g/mol. Its IUPAC name is (2S,3R)-2-benzyl-3-phenyl-1,2,3,4-tetrahydroquinoxaline.
| Compound Name | (2S,3R)-2-benzyl-3-phenyl-1,2,3,4-tetrahydroquinoxaline |
|---|---|
| PubChem CID | 132596105 |
| Molecular Formula | C21H20N2 |
| Molecular Weight | 300.41 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | (2S,3R)-2-benzyl-3-phenyl-1,2,3,4-tetrahydroquinoxaline |
| SMILES | c1ccc(C[C@@H]2Nc3ccccc3N[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H20N2/c1-3-9-16(10-4-1)15-20-21(17-11-5-2-6-12-17)23-19-14-8-7-13-18(19)22-20/h1-14,20-23H,15H2/t20-,21+/m0/s1 |
| InChIKey | QBXRECQOMFNOAJ-LEWJYISDSA-N |
| XLogP | 4.88 |
| TPSA | 24.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.41 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_NH_alk_C(2)', 'substructure': 'N/A'} |
|---|