About 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one
4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one (PubChem CID 132596148) has the molecular formula C19H24F3NO
and a molecular weight of 339.40 g/mol. Its IUPAC name is 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one.
Molecular Properties
| Compound Name | 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one |
| PubChem CID | 132596148 |
| Molecular Formula | C19H24F3NO |
| Molecular Weight | 339.40 g/mol |
| Exact Mass | 339.18 |
| IUPAC Name | 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one |
| SMILES | CN1CC(C)(CC2CCCCC2)c2cc(C(F)(F)F)ccc2C1=O |
| InChI | InChI=1S/C19H24F3NO/c1-18(11-13-6-4-3-5-7-13)12-23(2)17(24)15-9-8-14(10-16(15)18)19(20,21)22/h8-10,13H,3-7,11-12H2,1-2H3 |
| InChIKey | KCMKCQCZRLDHMK-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 339.40 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one?
The IUPAC name of 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one (CID 132596148) is 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one.
What is the SMILES notation for 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one?
The canonical SMILES for 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one is CN1CC(C)(CC2CCCCC2)c2cc(C(F)(F)F)ccc2C1=O.
What is the InChIKey of 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one?
The InChIKey is KCMKCQCZRLDHMK-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H24F3NO/c1-18(11-13-6-4-3-5-7-13)12-23(2)17(24)15-9-8-14(10-16(15)18)19(20,21)22/h8-10,13H,3-7,11-12H2,1-2H3.
What are the key properties of 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one?
4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one has a molecular weight of 339.40 g/mol, XLogP of 5.02, 2 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(cyclohexylmethyl)-2,4-dimethyl-6-(trifluoromethyl)-3H-isoquinolin-1-one is sourced from PubChem (CID 132596148), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).